C7H9NO2 — CID 163575650
amino cyclohexa-1,3-diene-1-carboxylate (PubChem CID 163575650) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is amino cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | amino cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 163575650 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | amino cyclohexa-1,3-diene-1-carboxylate |
| SMILES | NOC(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C7H9NO2/c8-10-7(9)6-4-2-1-3-5-6/h1-2,4H,3,5,8H2 |
| InChIKey | GDFQLZKCAZKAQQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|