C16H26O2 — CID 10988724
methyl (1E,3E)-cyclotetradeca-1,3-diene-1-carboxylate (PubChem CID 10988724) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is methyl (1E,3E)-cyclotetradeca-1,3-diene-1-carboxylate.
| Compound Name | methyl (1E,3E)-cyclotetradeca-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 10988724 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | methyl (1E,3E)-cyclotetradeca-1,3-diene-1-carboxylate |
| SMILES | COC(=O)/C1=C/C=C/CCCCCCCCCC1 |
| InChI | InChI=1S/C16H26O2/c1-18-16(17)15-13-11-9-7-5-3-2-4-6-8-10-12-14-15/h9,11,13H,2-8,10,12,14H2,1H3/b11-9+,15-13+ |
| InChIKey | AWASTMYTTXEUBD-PXELCPQFSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |