C16H28NO2+ — CID 166995232
2-(cyclohexa-1,3-diene-1-carbonyloxy)propyl-triethylazanium (PubChem CID 166995232) has the molecular formula C16H28NO2+ and a molecular weight of 266.40 g/mol. Its IUPAC name is 2-(cyclohexa-1,3-diene-1-carbonyloxy)propyl-triethylazanium.
| Compound Name | 2-(cyclohexa-1,3-diene-1-carbonyloxy)propyl-triethylazanium |
|---|---|
| PubChem CID | 166995232 |
| Molecular Formula | C16H28NO2+ |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-(cyclohexa-1,3-diene-1-carbonyloxy)propyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(C)OC(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C16H28NO2/c1-5-17(6-2,7-3)13-14(4)19-16(18)15-11-9-8-10-12-15/h8-9,11,14H,5-7,10,12-13H2,1-4H3/q+1 |
| InChIKey | AANQEUQIESOBGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|