C12H18N2 — CID 176522672
N-(1-cyclohexa-1,3-dien-1-yl-2-iminoethenyl)-2-methylpropan-1-amine (PubChem CID 176522672) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-(1-cyclohexa-1,3-dien-1-yl-2-iminoethenyl)-2-methylpropan-1-amine.
| Compound Name | N-(1-cyclohexa-1,3-dien-1-yl-2-iminoethenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 176522672 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-(1-cyclohexa-1,3-dien-1-yl-2-iminoethenyl)-2-methylpropan-1-amine |
| SMILES | CC(C)CNC(=C=N)C1=CC=CCC1 |
| InChI | InChI=1S/C12H18N2/c1-10(2)9-14-12(8-13)11-6-4-3-5-7-11/h3-4,6,10,13-14H,5,7,9H2,1-2H3 |
| InChIKey | VNFKPYZUCSGONY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|