C11H17FN2 — CID 134604072
(Z)-3-(2-fluoro-6-methyl-1,2-dihydropyridin-5-yl)pent-3-en-1-amine (PubChem CID 134604072) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is (Z)-3-(2-fluoro-6-methyl-1,2-dihydropyridin-5-yl)pent-3-en-1-amine.
| Compound Name | (Z)-3-(2-fluoro-6-methyl-1,2-dihydropyridin-5-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 134604072 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (Z)-3-(2-fluoro-6-methyl-1,2-dihydropyridin-5-yl)pent-3-en-1-amine |
| SMILES | C/C=C(/CCN)C1=C(C)NC(F)C=C1 |
| InChI | InChI=1S/C11H17FN2/c1-3-9(6-7-13)10-4-5-11(12)14-8(10)2/h3-5,11,14H,6-7,13H2,1-2H3/b9-3- |
| InChIKey | MTFAUVRCINEGEI-OQFOIZHKSA-N |
| XLogP | 2.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|