C15H25FN2 — CID 146550620
(2E,4Z,6E)-3-cyclopropyl-2-fluoro-4-N-(2-methylpropyl)octa-2,4,6-triene-4,5-diamine (PubChem CID 146550620) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is (2E,4Z,6E)-3-cyclopropyl-2-fluoro-4-N-(2-methylpropyl)octa-2,4,6-triene-4,5-diamine.
| Compound Name | (2E,4Z,6E)-3-cyclopropyl-2-fluoro-4-N-(2-methylpropyl)octa-2,4,6-triene-4,5-diamine |
|---|---|
| PubChem CID | 146550620 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (2E,4Z,6E)-3-cyclopropyl-2-fluoro-4-N-(2-methylpropyl)octa-2,4,6-triene-4,5-diamine |
| SMILES | C/C=C/C(N)=C(NCC(C)C)\C(=C(/C)F)C1CC1 |
| InChI | InChI=1S/C15H25FN2/c1-5-6-13(17)15(18-9-10(2)3)14(11(4)16)12-7-8-12/h5-6,10,12,18H,7-9,17H2,1-4H3/b6-5+,14-11+,15-13- |
| InChIKey | TXVYNKSOLVUCJK-BJGUEGTESA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|