C25H39FN2 — CID 130285114
3-N-[(3E,5E,6E)-5-[(Z)-but-2-enylidene]-10-fluoro-4,10-dimethylundeca-1,3,6-trien-2-yl]-1-N-ethenyl-2-ethylbut-3-ene-1,3-diamine (PubChem CID 130285114) has the molecular formula C25H39FN2 and a molecular weight of 386.60 g/mol. Its IUPAC name is 3-N-[(3E,5E,6E)-5-[(Z)-but-2-enylidene]-10-fluoro-4,10-dimethylundeca-1,3,6-trien-2-yl]-1-N-ethenyl-2-ethylbut-3-ene-1,3-diamine.
| Compound Name | 3-N-[(3E,5E,6E)-5-[(Z)-but-2-enylidene]-10-fluoro-4,10-dimethylundeca-1,3,6-trien-2-yl]-1-N-ethenyl-2-ethylbut-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 130285114 |
| Molecular Formula | C25H39FN2 |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | 3-N-[(3E,5E,6E)-5-[(Z)-but-2-enylidene]-10-fluoro-4,10-dimethylundeca-1,3,6-trien-2-yl]-1-N-ethenyl-2-ethylbut-3-ene-1,3-diamine |
| SMILES | C=CNCC(CC)C(=C)NC(=C)/C=C(C)/C(/C=C/CCC(C)(C)F)=C/C=C\C |
| InChI | InChI=1S/C25H39FN2/c1-9-12-15-24(16-13-14-17-25(7,8)26)20(4)18-21(5)28-22(6)23(10-2)19-27-11-3/h9,11-13,15-16,18,23,27-28H,3,5-6,10,14,17,19H2,1-2,4,7-8H3/b12-9-,16-13+,20-18+,24-15+ |
| InChIKey | MGFMAZRCTLSGEF-UGUYWYTBSA-N |
| XLogP | 6.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|