C25H35F6N3 — CID 130243388
(1Z,4Z)-1-N-[(3E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-1,3-dien-2-yl]-6,6,6-trifluoro-5-N,5-N-dimethyl-2-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]hexa-1,4-diene-1,3,5-triamine (PubChem CID 130243388) has the molecular formula C25H35F6N3 and a molecular weight of 491.56 g/mol. Its IUPAC name is (1Z,4Z)-1-N-[(3E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-1,3-dien-2-yl]-6,6,6-trifluoro-5-N,5-N-dimethyl-2-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]hexa-1,4-diene-1,3,5-triamine.
| Compound Name | (1Z,4Z)-1-N-[(3E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-1,3-dien-2-yl]-6,6,6-trifluoro-5-N,5-N-dimethyl-2-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]hexa-1,4-diene-1,3,5-triamine |
|---|---|
| PubChem CID | 130243388 |
| Molecular Formula | C25H35F6N3 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (1Z,4Z)-1-N-[(3E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-1,3-dien-2-yl]-6,6,6-trifluoro-5-N,5-N-dimethyl-2-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]hexa-1,4-diene-1,3,5-triamine |
| SMILES | C=C(C)/C(C(=C)N/C=C(/C=C(\C=C/C)C(F)(F)F)C(N)/C=C(\N(C)C)C(F)(F)F)=C(/C)C(C)C |
| InChI | InChI=1S/C25H35F6N3/c1-10-11-20(24(26,27)28)12-19(21(32)13-22(34(8)9)25(29,30)31)14-33-18(7)23(16(4)5)17(6)15(2)3/h10-15,21,33H,4,7,32H2,1-3,5-6,8-9H3/b11-10-,19-14-,20-12+,22-13-,23-17+ |
| InChIKey | FHLZMQKOVSAGHP-KSUPRSJZSA-N |
| XLogP | 6.92 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|