C20H29FN2 — CID 137465227
(1E,3E,5E)-8-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-1-N,2,3,6-tetramethylnona-1,3,5,8-tetraene-1,8-diamine (PubChem CID 137465227) has the molecular formula C20H29FN2 and a molecular weight of 316.46 g/mol. Its IUPAC name is (1E,3E,5E)-8-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-1-N,2,3,6-tetramethylnona-1,3,5,8-tetraene-1,8-diamine.
| Compound Name | (1E,3E,5E)-8-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-1-N,2,3,6-tetramethylnona-1,3,5,8-tetraene-1,8-diamine |
|---|---|
| PubChem CID | 137465227 |
| Molecular Formula | C20H29FN2 |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (1E,3E,5E)-8-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-1-N,2,3,6-tetramethylnona-1,3,5,8-tetraene-1,8-diamine |
| SMILES | C=C/C(=C\C(=C)F)CNC(=C)C/C(C)=C/C=C(C)/C(C)=C/NC |
| InChI | InChI=1S/C20H29FN2/c1-8-20(12-18(5)21)14-23-19(6)11-15(2)9-10-16(3)17(4)13-22-7/h8-10,12-13,22-23H,1,5-6,11,14H2,2-4,7H3/b15-9+,16-10+,17-13+,20-12+ |
| InChIKey | LTUASUUCZMXUBJ-UPQQJJSHSA-N |
| XLogP | 5.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|