C16H28FN — CID 126586946
(4Z,6Z)-N-(2,2-dimethylpropyl)-9-fluoro-9-methyldeca-1,4,6-trien-2-amine (PubChem CID 126586946) has the molecular formula C16H28FN and a molecular weight of 253.40 g/mol. Its IUPAC name is (4Z,6Z)-N-(2,2-dimethylpropyl)-9-fluoro-9-methyldeca-1,4,6-trien-2-amine.
| Compound Name | (4Z,6Z)-N-(2,2-dimethylpropyl)-9-fluoro-9-methyldeca-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 126586946 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | (4Z,6Z)-N-(2,2-dimethylpropyl)-9-fluoro-9-methyldeca-1,4,6-trien-2-amine |
| SMILES | C=C(C/C=C\C=C/CC(C)(C)F)NCC(C)(C)C |
| InChI | InChI=1S/C16H28FN/c1-14(18-13-15(2,3)4)11-9-7-8-10-12-16(5,6)17/h7-10,18H,1,11-13H2,2-6H3/b9-7-,10-8- |
| InChIKey | BSHLCQFIQGWDKM-XOHWUJONSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|