C27H44FN — CID 126586993
(4Z,6E,7E,9Z)-6-(3-fluoro-3-methylbutylidene)-N-hepta-1,6-dien-2-yl-2,2,7,9-tetramethylundeca-4,7,9-trien-1-amine (PubChem CID 126586993) has the molecular formula C27H44FN and a molecular weight of 401.65 g/mol. Its IUPAC name is (4Z,6E,7E,9Z)-6-(3-fluoro-3-methylbutylidene)-N-hepta-1,6-dien-2-yl-2,2,7,9-tetramethylundeca-4,7,9-trien-1-amine.
| Compound Name | (4Z,6E,7E,9Z)-6-(3-fluoro-3-methylbutylidene)-N-hepta-1,6-dien-2-yl-2,2,7,9-tetramethylundeca-4,7,9-trien-1-amine |
|---|---|
| PubChem CID | 126586993 |
| Molecular Formula | C27H44FN |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | (4Z,6E,7E,9Z)-6-(3-fluoro-3-methylbutylidene)-N-hepta-1,6-dien-2-yl-2,2,7,9-tetramethylundeca-4,7,9-trien-1-amine |
| SMILES | C=CCCCC(=C)NCC(C)(C)C/C=C\C(=C/CC(C)(C)F)\C(C)=C\C(C)=C/C |
| InChI | InChI=1S/C27H44FN/c1-10-12-13-15-24(5)29-21-26(6,7)18-14-16-25(17-19-27(8,9)28)23(4)20-22(3)11-2/h10-11,14,16-17,20,29H,1,5,12-13,15,18-19,21H2,2-4,6-9H3/b16-14-,22-11-,23-20+,25-17+ |
| InChIKey | DSADMMHVMVRLCD-NGTDHQKJSA-N |
| XLogP | 8.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|