C30H49FN4 — CID 134187771
(3E,5Z)-5-(1-aminoethenyl)-6-N-[(3E,5E)-5,6-dimethylocta-1,3,5-trien-3-yl]-2-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-fluorohepta-1,3,5-triene-2,6-diamine (PubChem CID 134187771) has the molecular formula C30H49FN4 and a molecular weight of 484.75 g/mol. Its IUPAC name is (3E,5Z)-5-(1-aminoethenyl)-6-N-[(3E,5E)-5,6-dimethylocta-1,3,5-trien-3-yl]-2-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-fluorohepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3E,5Z)-5-(1-aminoethenyl)-6-N-[(3E,5E)-5,6-dimethylocta-1,3,5-trien-3-yl]-2-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-fluorohepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187771 |
| Molecular Formula | C30H49FN4 |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | (3E,5Z)-5-(1-aminoethenyl)-6-N-[(3E,5E)-5,6-dimethylocta-1,3,5-trien-3-yl]-2-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-fluorohepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C/C(=C\C(C)=C(/C)CC)N/C(C)=C(/C=C(/F)C(=C)NC(C)[C@H](C)NC(=C)CC(C)(C)C)C(=C)N |
| InChI | InChI=1S/C30H49FN4/c1-14-19(3)20(4)16-27(15-2)35-25(9)28(22(6)32)17-29(31)26(10)34-24(8)23(7)33-21(5)18-30(11,12)13/h15-17,23-24,33-35H,2,5-6,10,14,18,32H2,1,3-4,7-9,11-13H3/b20-19+,27-16+,28-25-,29-17+/t23-,24?/m0/s1 |
| InChIKey | GHRKFCVNJBTOPG-KLPOWLIGSA-N |
| XLogP | 7.41 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|