C26H37FN2 — CID 142190245
(E,4E)-5-N-[(3E)-4-(5-fluorocyclohepta-1,4,6-trien-1-yl)buta-1,3-dien-2-yl]-4-prop-2-enylidene-2-N,2-N-dipropylhex-2-ene-2,5-diamine (PubChem CID 142190245) has the molecular formula C26H37FN2 and a molecular weight of 396.59 g/mol. Its IUPAC name is (E,4E)-5-N-[(3E)-4-(5-fluorocyclohepta-1,4,6-trien-1-yl)buta-1,3-dien-2-yl]-4-prop-2-enylidene-2-N,2-N-dipropylhex-2-ene-2,5-diamine.
| Compound Name | (E,4E)-5-N-[(3E)-4-(5-fluorocyclohepta-1,4,6-trien-1-yl)buta-1,3-dien-2-yl]-4-prop-2-enylidene-2-N,2-N-dipropylhex-2-ene-2,5-diamine |
|---|---|
| PubChem CID | 142190245 |
| Molecular Formula | C26H37FN2 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (E,4E)-5-N-[(3E)-4-(5-fluorocyclohepta-1,4,6-trien-1-yl)buta-1,3-dien-2-yl]-4-prop-2-enylidene-2-N,2-N-dipropylhex-2-ene-2,5-diamine |
| SMILES | C=C/C=C(\C=C(/C)N(CCC)CCC)C(C)NC(=C)/C=C/C1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C26H37FN2/c1-7-11-25(20-22(5)29(18-8-2)19-9-3)23(6)28-21(4)14-15-24-12-10-13-26(27)17-16-24/h7,11-17,20,23,28H,1,4,8-10,18-19H2,2-3,5-6H3/b15-14+,22-20+,25-11+ |
| InChIKey | RHJPXVNHYMGVKM-LMBUUFIZSA-N |
| XLogP | 6.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|