C27H41FN2 — CID 134478957
6-(1-aminopropyl)-N-[(6Z,10Z)-12-fluoro-4,10-dimethyl-9-propan-2-ylidenedodeca-6,10-dien-4-yl]cyclohepta-1,3,4,6-tetraen-1-amine (PubChem CID 134478957) has the molecular formula C27H41FN2 and a molecular weight of 412.64 g/mol. Its IUPAC name is 6-(1-aminopropyl)-N-[(6Z,10Z)-12-fluoro-4,10-dimethyl-9-propan-2-ylidenedodeca-6,10-dien-4-yl]cyclohepta-1,3,4,6-tetraen-1-amine.
| Compound Name | 6-(1-aminopropyl)-N-[(6Z,10Z)-12-fluoro-4,10-dimethyl-9-propan-2-ylidenedodeca-6,10-dien-4-yl]cyclohepta-1,3,4,6-tetraen-1-amine |
|---|---|
| PubChem CID | 134478957 |
| Molecular Formula | C27H41FN2 |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 6-(1-aminopropyl)-N-[(6Z,10Z)-12-fluoro-4,10-dimethyl-9-propan-2-ylidenedodeca-6,10-dien-4-yl]cyclohepta-1,3,4,6-tetraen-1-amine |
| SMILES | CCCC(C)(C/C=C\CC(=C(C)C)/C(C)=C\CF)NC1=CC=C=CC(C(N)CC)=C1 |
| InChI | InChI=1S/C27H41FN2/c1-7-17-27(6,18-12-11-15-25(21(3)4)22(5)16-19-28)30-24-14-10-9-13-23(20-24)26(29)8-2/h10-14,16,20,26,30H,7-8,15,17-19,29H2,1-6H3/b12-11-,22-16- |
| InChIKey | DITRSWKGNGQYIE-XUNGAJRUSA-N |
| XLogP | 7.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|