C36H67FN2 — CID 126514707
(E)-5-N-[(Z)-2,6-diethyl-2-fluorooct-4-enyl]-2-N,6,6-trimethyl-2-N-[(Z)-2,3,6-trimethyl-5-methylidenedec-3-en-2-yl]hept-4-ene-2,5-diamine (PubChem CID 126514707) has the molecular formula C36H67FN2 and a molecular weight of 546.94 g/mol. Its IUPAC name is (E)-5-N-[(Z)-2,6-diethyl-2-fluorooct-4-enyl]-2-N,6,6-trimethyl-2-N-[(Z)-2,3,6-trimethyl-5-methylidenedec-3-en-2-yl]hept-4-ene-2,5-diamine.
| Compound Name | (E)-5-N-[(Z)-2,6-diethyl-2-fluorooct-4-enyl]-2-N,6,6-trimethyl-2-N-[(Z)-2,3,6-trimethyl-5-methylidenedec-3-en-2-yl]hept-4-ene-2,5-diamine |
|---|---|
| PubChem CID | 126514707 |
| Molecular Formula | C36H67FN2 |
| Molecular Weight | 546.94 g/mol |
| Exact Mass | 546.53 |
| IUPAC Name | (E)-5-N-[(Z)-2,6-diethyl-2-fluorooct-4-enyl]-2-N,6,6-trimethyl-2-N-[(Z)-2,3,6-trimethyl-5-methylidenedec-3-en-2-yl]hept-4-ene-2,5-diamine |
| SMILES | C=C(/C=C(/C)C(C)(C)N(C)C(C)C/C=C(/NCC(F)(CC)C/C=C\C(CC)CC)C(C)(C)C)C(C)CCCC |
| InChI | InChI=1S/C36H67FN2/c1-15-19-21-28(5)29(6)26-30(7)35(12,13)39(14)31(8)23-24-33(34(9,10)11)38-27-36(37,18-4)25-20-22-32(16-2)17-3/h20,22,24,26,28,31-32,38H,6,15-19,21,23,25,27H2,1-5,7-14H3/b22-20-,30-26-,33-24+ |
| InChIKey | AYUJNAJHOXSPPM-LMZWWFEWSA-N |
| XLogP | 10.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.94 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|