C21H32FN — CID 156519348
(3E,5Z)-N-[3-[(1S)-3-[(Z)-but-1-enyl]-1-methylcyclobut-2-en-1-yl]propyl]-7-fluoro-2-methylocta-1,3,5-trien-4-amine (PubChem CID 156519348) has the molecular formula C21H32FN and a molecular weight of 317.49 g/mol. Its IUPAC name is (3E,5Z)-N-[3-[(1S)-3-[(Z)-but-1-enyl]-1-methylcyclobut-2-en-1-yl]propyl]-7-fluoro-2-methylocta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-[3-[(1S)-3-[(Z)-but-1-enyl]-1-methylcyclobut-2-en-1-yl]propyl]-7-fluoro-2-methylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 156519348 |
| Molecular Formula | C21H32FN |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (3E,5Z)-N-[3-[(1S)-3-[(Z)-but-1-enyl]-1-methylcyclobut-2-en-1-yl]propyl]-7-fluoro-2-methylocta-1,3,5-trien-4-amine |
| SMILES | C=C(C)/C=C(\C=C/C(C)F)NCCC[C@]1(C)C=C(/C=C\CC)C1 |
| InChI | InChI=1S/C21H32FN/c1-6-7-9-19-15-21(5,16-19)12-8-13-23-20(14-17(2)3)11-10-18(4)22/h7,9-11,14-15,18,23H,2,6,8,12-13,16H2,1,3-5H3/b9-7-,11-10-,20-14+/t18?,21-/m1/s1 |
| InChIKey | VIJLLWRZYMINGR-BJPHBNJCSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|