C28H45FN2S — CID 130243165
(3Z)-3-[[[(3Z,6E,8Z)-10-fluoro-9-(methylamino)-4-[(Z)-prop-1-enyl]undeca-1,3,6,8-tetraen-6-yl]amino]methyl]-2,5,5-trimethylnona-1,3-diene-4-thiol (PubChem CID 130243165) has the molecular formula C28H45FN2S and a molecular weight of 460.75 g/mol. Its IUPAC name is (3Z)-3-[[[(3Z,6E,8Z)-10-fluoro-9-(methylamino)-4-[(Z)-prop-1-enyl]undeca-1,3,6,8-tetraen-6-yl]amino]methyl]-2,5,5-trimethylnona-1,3-diene-4-thiol.
| Compound Name | (3Z)-3-[[[(3Z,6E,8Z)-10-fluoro-9-(methylamino)-4-[(Z)-prop-1-enyl]undeca-1,3,6,8-tetraen-6-yl]amino]methyl]-2,5,5-trimethylnona-1,3-diene-4-thiol |
|---|---|
| PubChem CID | 130243165 |
| Molecular Formula | C28H45FN2S |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (3Z)-3-[[[(3Z,6E,8Z)-10-fluoro-9-(methylamino)-4-[(Z)-prop-1-enyl]undeca-1,3,6,8-tetraen-6-yl]amino]methyl]-2,5,5-trimethylnona-1,3-diene-4-thiol |
| SMILES | C=C/C=C(\C=C/C)C/C(=C\C=C(/NC)C(C)F)NC/C(C(=C)C)=C(\S)C(C)(C)CCCC |
| InChI | InChI=1S/C28H45FN2S/c1-10-13-18-28(7,8)27(32)25(21(4)5)20-31-24(16-17-26(30-9)22(6)29)19-23(14-11-2)15-12-3/h11-12,14-17,22,30-32H,2,4,10,13,18-20H2,1,3,5-9H3/b15-12-,23-14+,24-16+,26-17-,27-25+ |
| InChIKey | ZJPVYSWMZAOHSB-GZOWUYQISA-N |
| XLogP | 7.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|