C20H35N — CID 167384763
(2Z,4Z)-3,4-ditert-butyl-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hexa-2,4-dien-1-amine (PubChem CID 167384763) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (2Z,4Z)-3,4-ditert-butyl-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hexa-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-3,4-ditert-butyl-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 167384763 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (2Z,4Z)-3,4-ditert-butyl-N-[(2E,4Z)-hexa-2,4-dien-3-yl]hexa-2,4-dien-1-amine |
| SMILES | C/C=C\C(=C/C)NC/C=C(C(=C/C)\C(C)(C)C)/C(C)(C)C |
| InChI | InChI=1S/C20H35N/c1-10-13-16(11-2)21-15-14-18(20(7,8)9)17(12-3)19(4,5)6/h10-14,21H,15H2,1-9H3/b13-10-,16-11+,17-12+,18-14+ |
| InChIKey | OECPFHOFAALDSM-JCGLFVRHSA-N |
| XLogP | 6.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|