C21H37N — CID 167004182
(3E,6E)-7,10,10-trimethyl-N-(2-methylhex-1-en-3-yl)undeca-1,3,6-trien-3-amine (PubChem CID 167004182) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is (3E,6E)-7,10,10-trimethyl-N-(2-methylhex-1-en-3-yl)undeca-1,3,6-trien-3-amine.
| Compound Name | (3E,6E)-7,10,10-trimethyl-N-(2-methylhex-1-en-3-yl)undeca-1,3,6-trien-3-amine |
|---|---|
| PubChem CID | 167004182 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | (3E,6E)-7,10,10-trimethyl-N-(2-methylhex-1-en-3-yl)undeca-1,3,6-trien-3-amine |
| SMILES | C=C/C(=C\C/C=C(\C)CCC(C)(C)C)NC(CCC)C(=C)C |
| InChI | InChI=1S/C21H37N/c1-9-12-20(17(3)4)22-19(10-2)14-11-13-18(5)15-16-21(6,7)8/h10,13-14,20,22H,2-3,9,11-12,15-16H2,1,4-8H3/b18-13+,19-14+ |
| InChIKey | OXHUJVYYZZRQTM-JIBZRZDWSA-N |
| XLogP | 6.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|