C27H42FN3 — CID 134478962
(4Z,6E)-7-N-[(3Z,5E)-5-(4-fluoro-1,2-dimethylcyclohexa-2,4-dien-1-yl)octa-3,5-dien-2-yl]-1-N-methyldeca-4,6,9-triene-1,2,7-triamine (PubChem CID 134478962) has the molecular formula C27H42FN3 and a molecular weight of 427.65 g/mol. Its IUPAC name is (4Z,6E)-7-N-[(3Z,5E)-5-(4-fluoro-1,2-dimethylcyclohexa-2,4-dien-1-yl)octa-3,5-dien-2-yl]-1-N-methyldeca-4,6,9-triene-1,2,7-triamine.
| Compound Name | (4Z,6E)-7-N-[(3Z,5E)-5-(4-fluoro-1,2-dimethylcyclohexa-2,4-dien-1-yl)octa-3,5-dien-2-yl]-1-N-methyldeca-4,6,9-triene-1,2,7-triamine |
|---|---|
| PubChem CID | 134478962 |
| Molecular Formula | C27H42FN3 |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | (4Z,6E)-7-N-[(3Z,5E)-5-(4-fluoro-1,2-dimethylcyclohexa-2,4-dien-1-yl)octa-3,5-dien-2-yl]-1-N-methyldeca-4,6,9-triene-1,2,7-triamine |
| SMILES | C=CC/C(=C\C=C/CC(N)CNC)NC(C)/C=C\C(=C/CC)C1(C)CC=C(F)C=C1C |
| InChI | InChI=1S/C27H42FN3/c1-7-11-23(27(5)18-17-24(28)19-21(27)3)16-15-22(4)31-26(12-8-2)14-10-9-13-25(29)20-30-6/h8-11,14-17,19,22,25,30-31H,2,7,12-13,18,20,29H2,1,3-6H3/b10-9-,16-15-,23-11+,26-14+ |
| InChIKey | NWQZYXXHJCDSDI-PXMUZDPBSA-N |
| XLogP | 6.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|