C20H32FN3 — CID 134187626
(3E)-5-[[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]amino]-4-fluoro-2-propan-2-ylidenehexa-3,5-dienenitrile (PubChem CID 134187626) has the molecular formula C20H32FN3 and a molecular weight of 333.50 g/mol. Its IUPAC name is (3E)-5-[[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]amino]-4-fluoro-2-propan-2-ylidenehexa-3,5-dienenitrile.
| Compound Name | (3E)-5-[[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]amino]-4-fluoro-2-propan-2-ylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 134187626 |
| Molecular Formula | C20H32FN3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | (3E)-5-[[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]amino]-4-fluoro-2-propan-2-ylidenehexa-3,5-dienenitrile |
| SMILES | C=C(CC(C)(C)C)N[C@@H](C)C(C)NC(=C)/C(F)=C\C(C#N)=C(C)C |
| InChI | InChI=1S/C20H32FN3/c1-13(2)18(12-22)10-19(21)17(6)24-16(5)15(4)23-14(3)11-20(7,8)9/h10,15-16,23-24H,3,6,11H2,1-2,4-5,7-9H3/b19-10+/t15-,16?/m0/s1 |
| InChIKey | IQAPZEWELJWQGL-HPVITXRASA-N |
| XLogP | 5.12 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|