C28H44FN3 — CID 134187723
(3Z,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-ethenyl-5-fluoro-2-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]hepta-1,3,5-triene-2,6-diamine (PubChem CID 134187723) has the molecular formula C28H44FN3 and a molecular weight of 441.68 g/mol. Its IUPAC name is (3Z,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-ethenyl-5-fluoro-2-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]hepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3Z,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-ethenyl-5-fluoro-2-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]hepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187723 |
| Molecular Formula | C28H44FN3 |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | (3Z,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)butan-2-yl]-3-ethenyl-5-fluoro-2-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]hepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C/C(C)=C\C(=C/C)NC(=C)/C(C=C)=C\C(F)=C(/C)NC(C)[C@H](C)NC(=C)CC(C)(C)C |
| InChI | InChI=1S/C28H44FN3/c1-13-19(4)16-26(15-3)32-23(8)25(14-2)17-27(29)24(9)31-22(7)21(6)30-20(5)18-28(10,11)12/h13-17,21-22,30-32H,1-2,5,8,18H2,3-4,6-7,9-12H3/b19-16-,25-17-,26-15+,27-24-/t21-,22?/m0/s1 |
| InChIKey | PNRKKFPJIJVJOA-NJFBZFNUSA-N |
| XLogP | 7.35 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|