C16H31N3 — CID 135269152
(3E)-3-N-[(Z)-2-ethyl-2-methylpent-3-enyl]-2-N,3-N,4-N-trimethylpenta-1,3-diene-2,3,4-triamine (PubChem CID 135269152) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (3E)-3-N-[(Z)-2-ethyl-2-methylpent-3-enyl]-2-N,3-N,4-N-trimethylpenta-1,3-diene-2,3,4-triamine.
| Compound Name | (3E)-3-N-[(Z)-2-ethyl-2-methylpent-3-enyl]-2-N,3-N,4-N-trimethylpenta-1,3-diene-2,3,4-triamine |
|---|---|
| PubChem CID | 135269152 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (3E)-3-N-[(Z)-2-ethyl-2-methylpent-3-enyl]-2-N,3-N,4-N-trimethylpenta-1,3-diene-2,3,4-triamine |
| SMILES | C=C(NC)/C(=C(/C)NC)N(C)CC(C)(/C=C\C)CC |
| InChI | InChI=1S/C16H31N3/c1-9-11-16(5,10-2)12-19(8)15(13(3)17-6)14(4)18-7/h9,11,17-18H,3,10,12H2,1-2,4-8H3/b11-9-,15-14+ |
| InChIKey | CQSNXKSJLDEIHO-DVRQTUGZSA-N |
| XLogP | 3.09 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|