C19H35N3 — CID 142510814
4,4-dimethyl-N-[2-[4-[(2E)-4-methylpenta-2,4-dienyl]piperazin-1-yl]ethyl]pent-1-en-2-amine (PubChem CID 142510814) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 4,4-dimethyl-N-[2-[4-[(2E)-4-methylpenta-2,4-dienyl]piperazin-1-yl]ethyl]pent-1-en-2-amine.
| Compound Name | 4,4-dimethyl-N-[2-[4-[(2E)-4-methylpenta-2,4-dienyl]piperazin-1-yl]ethyl]pent-1-en-2-amine |
|---|---|
| PubChem CID | 142510814 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 4,4-dimethyl-N-[2-[4-[(2E)-4-methylpenta-2,4-dienyl]piperazin-1-yl]ethyl]pent-1-en-2-amine |
| SMILES | C=C(C)/C=C/CN1CCN(CCNC(=C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H35N3/c1-17(2)8-7-10-21-12-14-22(15-13-21)11-9-20-18(3)16-19(4,5)6/h7-8,20H,1,3,9-16H2,2,4-6H3/b8-7+ |
| InChIKey | JNXLDWOWVSDXFT-BQYQJAHWSA-N |
| XLogP | 3.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|