C19H36N2 — CID 88957766
(3Z)-3-tert-butyl-6-methyl-N-(2-piperidin-1-ylethyl)hepta-3,5-dien-2-amine (PubChem CID 88957766) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is (3Z)-3-tert-butyl-6-methyl-N-(2-piperidin-1-ylethyl)hepta-3,5-dien-2-amine.
| Compound Name | (3Z)-3-tert-butyl-6-methyl-N-(2-piperidin-1-ylethyl)hepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 88957766 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | (3Z)-3-tert-butyl-6-methyl-N-(2-piperidin-1-ylethyl)hepta-3,5-dien-2-amine |
| SMILES | CC(C)=C/C=C(\C(C)NCCN1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H36N2/c1-16(2)10-11-18(19(4,5)6)17(3)20-12-15-21-13-8-7-9-14-21/h10-11,17,20H,7-9,12-15H2,1-6H3/b18-11+ |
| InChIKey | UYBUQNJESVMZJO-WOJGMQOQSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|