C36H64N2 — CID 167385042
(2E)-5-methyl-1-N-[(2E,8E)-4,4,7,7-tetramethyldeca-2,8-dienyl]-3-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]hexa-2,4-diene-1,3-diamine (PubChem CID 167385042) has the molecular formula C36H64N2 and a molecular weight of 524.92 g/mol. Its IUPAC name is (2E)-5-methyl-1-N-[(2E,8E)-4,4,7,7-tetramethyldeca-2,8-dienyl]-3-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]hexa-2,4-diene-1,3-diamine.
| Compound Name | (2E)-5-methyl-1-N-[(2E,8E)-4,4,7,7-tetramethyldeca-2,8-dienyl]-3-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]hexa-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 167385042 |
| Molecular Formula | C36H64N2 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.51 |
| IUPAC Name | (2E)-5-methyl-1-N-[(2E,8E)-4,4,7,7-tetramethyldeca-2,8-dienyl]-3-N-[(2E,8E)-4,4,7,7-tetramethylundeca-2,8-dienyl]hexa-2,4-diene-1,3-diamine |
| SMILES | C/C=C/C(C)(C)CCC(C)(C)/C=C/CNC/C=C(\C=C(C)C)NC/C=C/C(C)(C)CCC(C)(C)/C=C/CC |
| InChI | InChI=1S/C36H64N2/c1-13-15-20-34(7,8)25-26-36(11,12)22-17-28-38-32(30-31(3)4)18-29-37-27-16-21-35(9,10)24-23-33(5,6)19-14-2/h14-22,30,37-38H,13,23-29H2,1-12H3/b19-14+,20-15+,21-16+,22-17+,32-18+ |
| InChIKey | LVLSECDCMDQZIR-GIDLBEJFSA-N |
| XLogP | 10.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|