C32H44N2 — CID 126746023
(3Z,6Z)-3-[(1Z,4E,6Z,8Z,9Z)-2-ethenyl-8-ethylidene-4,9-dimethyl-6-prop-2-enylidenedodeca-1,4,9,11-tetraenyl]-2-N,7-dimethylnona-1,3,6,8-tetraene-2,4-diamine (PubChem CID 126746023) has the molecular formula C32H44N2 and a molecular weight of 456.72 g/mol. Its IUPAC name is (3Z,6Z)-3-[(1Z,4E,6Z,8Z,9Z)-2-ethenyl-8-ethylidene-4,9-dimethyl-6-prop-2-enylidenedodeca-1,4,9,11-tetraenyl]-2-N,7-dimethylnona-1,3,6,8-tetraene-2,4-diamine.
| Compound Name | (3Z,6Z)-3-[(1Z,4E,6Z,8Z,9Z)-2-ethenyl-8-ethylidene-4,9-dimethyl-6-prop-2-enylidenedodeca-1,4,9,11-tetraenyl]-2-N,7-dimethylnona-1,3,6,8-tetraene-2,4-diamine |
|---|---|
| PubChem CID | 126746023 |
| Molecular Formula | C32H44N2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (3Z,6Z)-3-[(1Z,4E,6Z,8Z,9Z)-2-ethenyl-8-ethylidene-4,9-dimethyl-6-prop-2-enylidenedodeca-1,4,9,11-tetraenyl]-2-N,7-dimethylnona-1,3,6,8-tetraene-2,4-diamine |
| SMILES | C=C/C=C(\C=C(/C)C/C(C=C)=C/C(C(=C)NC)=C(/N)C/C=C(/C)C=C)CC(=C/C)/C(C)=C\C=C |
| InChI | InChI=1S/C32H44N2/c1-11-16-26(8)30(15-5)22-29(17-12-2)21-25(7)20-28(14-4)23-31(27(9)34-10)32(33)19-18-24(6)13-3/h11-18,21,23,34H,1-4,9,19-20,22,33H2,5-8,10H3/b24-18-,25-21+,26-16-,28-23+,29-17+,30-15-,32-31- |
| InChIKey | KIQSZVGLAIEWAQ-VBWSKBFJSA-N |
| XLogP | 8.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|