C24H36N2 — CID 118145653
(1E,3Z)-2-[(1E)-buta-1,3-dienyl]-N-[(2E,4Z,7Z)-9-methyl-7-[(Z)-prop-1-enyl]undeca-2,4,7-trien-3-yl]penta-1,3-diene-1,5-diamine (PubChem CID 118145653) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is (1E,3Z)-2-[(1E)-buta-1,3-dienyl]-N-[(2E,4Z,7Z)-9-methyl-7-[(Z)-prop-1-enyl]undeca-2,4,7-trien-3-yl]penta-1,3-diene-1,5-diamine.
| Compound Name | (1E,3Z)-2-[(1E)-buta-1,3-dienyl]-N-[(2E,4Z,7Z)-9-methyl-7-[(Z)-prop-1-enyl]undeca-2,4,7-trien-3-yl]penta-1,3-diene-1,5-diamine |
|---|---|
| PubChem CID | 118145653 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | (1E,3Z)-2-[(1E)-buta-1,3-dienyl]-N-[(2E,4Z,7Z)-9-methyl-7-[(Z)-prop-1-enyl]undeca-2,4,7-trien-3-yl]penta-1,3-diene-1,5-diamine |
| SMILES | C=C/C=C/C(/C=C\CN)=C\NC(/C=C\CC(/C=C\C)=C/C(C)CC)=C/C |
| InChI | InChI=1S/C24H36N2/c1-6-10-14-23(16-12-18-25)20-26-24(9-4)17-11-15-22(13-7-2)19-21(5)8-3/h6-7,9-14,16-17,19-21,26H,1,8,15,18,25H2,2-5H3/b13-7-,14-10+,16-12-,17-11-,22-19+,23-20+,24-9+ |
| InChIKey | MKPIZKNDFMNKMO-KGBZLLFUSA-N |
| XLogP | 6.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|