C11H18FN — CID 134533169
(2Z,4E)-N-ethenyl-5-fluoro-3-propan-2-ylhexa-2,4-dien-2-amine (PubChem CID 134533169) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (2Z,4E)-N-ethenyl-5-fluoro-3-propan-2-ylhexa-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-N-ethenyl-5-fluoro-3-propan-2-ylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134533169 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2Z,4E)-N-ethenyl-5-fluoro-3-propan-2-ylhexa-2,4-dien-2-amine |
| SMILES | C=CN/C(C)=C(\C=C(/C)F)C(C)C |
| InChI | InChI=1S/C11H18FN/c1-6-13-10(5)11(8(2)3)7-9(4)12/h6-8,13H,1H2,2-5H3/b9-7+,11-10+ |
| InChIKey | HNQRCDRNZKJZBF-RJECPTDASA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|