C10H18FN — CID 130233741
(Z)-N-(1-fluoroprop-2-enyl)-5-methylhex-2-en-2-amine (PubChem CID 130233741) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (Z)-N-(1-fluoroprop-2-enyl)-5-methylhex-2-en-2-amine.
| Compound Name | (Z)-N-(1-fluoroprop-2-enyl)-5-methylhex-2-en-2-amine |
|---|---|
| PubChem CID | 130233741 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (Z)-N-(1-fluoroprop-2-enyl)-5-methylhex-2-en-2-amine |
| SMILES | C=CC(F)N/C(C)=C\CC(C)C |
| InChI | InChI=1S/C10H18FN/c1-5-10(11)12-9(4)7-6-8(2)3/h5,7-8,10,12H,1,6H2,2-4H3/b9-7- |
| InChIKey | VGYACUHCNKDEGQ-CLFYSBASSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|