C12H18FN — CID 142089087
(3E)-3-fluoro-5-methyl-N-(3-methylbut-2-enyl)hexa-1,3,5-trien-2-amine (PubChem CID 142089087) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (3E)-3-fluoro-5-methyl-N-(3-methylbut-2-enyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-3-fluoro-5-methyl-N-(3-methylbut-2-enyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142089087 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (3E)-3-fluoro-5-methyl-N-(3-methylbut-2-enyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C(/F)C(=C)NCC=C(C)C |
| InChI | InChI=1S/C12H18FN/c1-9(2)6-7-14-11(5)12(13)8-10(3)4/h6,8,14H,3,5,7H2,1-2,4H3/b12-8+ |
| InChIKey | VDUGMWIXTGXYEX-XYOKQWHBSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|