About 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine
5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine (PubChem CID 130272610) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine.
Analyze 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine?
The IUPAC name of 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine (CID 130272610) is 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine is CNC1=CC=CC(C)(F)C=C1.
What is the InChIKey of 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine?
The InChIKey is GBWPFNKLAHWIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c1-9(10)6-3-4-8(11-2)5-7-9/h3-7,11H,1-2H3.
What are the key properties of 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine?
5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine has a molecular weight of 153.20 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,5-dimethylcyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 130272610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).