C15H26FN — CID 126583190
(2Z,4E)-4-fluoro-6-methyl-N-(3-methylpent-1-enyl)octa-2,4-dien-1-amine (PubChem CID 126583190) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (2Z,4E)-4-fluoro-6-methyl-N-(3-methylpent-1-enyl)octa-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-4-fluoro-6-methyl-N-(3-methylpent-1-enyl)octa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 126583190 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (2Z,4E)-4-fluoro-6-methyl-N-(3-methylpent-1-enyl)octa-2,4-dien-1-amine |
| SMILES | CCC(C)C=CNC/C=C\C(F)=C/C(C)CC |
| InChI | InChI=1S/C15H26FN/c1-5-13(3)9-11-17-10-7-8-15(16)12-14(4)6-2/h7-9,11-14,17H,5-6,10H2,1-4H3/b8-7-,11-9?,15-12+ |
| InChIKey | OENJLKIERPRMHX-QVODSAEJSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|