C10H16FN — CID 139543830
(1Z,3E,5Z)-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine (PubChem CID 139543830) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (1Z,3E,5Z)-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E,5Z)-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 139543830 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (1Z,3E,5Z)-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(F)=C(/C=C\N)C(C)C |
| InChI | InChI=1S/C10H16FN/c1-4-5-10(11)9(6-7-12)8(2)3/h4-8H,12H2,1-3H3/b5-4-,7-6-,10-9- |
| InChIKey | WPIPOBBUXKAKJX-FJWOGVSGSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|