C10H14F3N — CID 89033831
(1Z,3E)-6-methyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-dien-1-amine (PubChem CID 89033831) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (1Z,3E)-6-methyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-6-methyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89033831 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1Z,3E)-6-methyl-5-methylidene-3-(trifluoromethyl)hepta-1,3-dien-1-amine |
| SMILES | C=C(/C=C(\C=C/N)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H14F3N/c1-7(2)8(3)6-9(4-5-14)10(11,12)13/h4-7H,3,14H2,1-2H3/b5-4-,9-6+ |
| InChIKey | IRMMWPGTVDSTQE-KMOPYBJPSA-N |
| XLogP | 3.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|