C8H10F3N — CID 89129506
(1E,3Z)-5-methyl-2-(trifluoromethyl)hexa-1,3,5-trien-1-amine (PubChem CID 89129506) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (1E,3Z)-5-methyl-2-(trifluoromethyl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-methyl-2-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89129506 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (1E,3Z)-5-methyl-2-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(C)/C=C\C(=C/N)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-6(2)3-4-7(5-12)8(9,10)11/h3-5H,1,12H2,2H3/b4-3-,7-5+ |
| InChIKey | VJIBTGUMPBCILC-QVXLNCAUSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|