C7H10FN — CID 88579423
(1Z,3Z)-5-fluoro-2-methylhexa-1,3,5-trien-1-amine (PubChem CID 88579423) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (1Z,3Z)-5-fluoro-2-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-5-fluoro-2-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88579423 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (1Z,3Z)-5-fluoro-2-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(F)/C=C\C(C)=C/N |
| InChI | InChI=1S/C7H10FN/c1-6(5-9)3-4-7(2)8/h3-5H,2,9H2,1H3/b4-3-,6-5- |
| InChIKey | SCDREKXVPAGHRO-OUPQRBNQSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|