C9H14F3N — CID 89073932
(2Z)-2-methyl-4-(trifluoromethyl)hepta-2,6-dien-1-amine (PubChem CID 89073932) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (2Z)-2-methyl-4-(trifluoromethyl)hepta-2,6-dien-1-amine.
| Compound Name | (2Z)-2-methyl-4-(trifluoromethyl)hepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 89073932 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2Z)-2-methyl-4-(trifluoromethyl)hepta-2,6-dien-1-amine |
| SMILES | C=CCC(/C=C(/C)CN)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-3-4-8(9(10,11)12)5-7(2)6-13/h3,5,8H,1,4,6,13H2,2H3/b7-5- |
| InChIKey | ZADCIZNXCUBJMD-ALCCZGGFSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|