C10H14F3N — CID 89270021
(2Z,4Z,6Z)-2-methyl-3-(trifluoromethyl)octa-2,4,6-trien-1-amine (PubChem CID 89270021) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (2Z,4Z,6Z)-2-methyl-3-(trifluoromethyl)octa-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z,6Z)-2-methyl-3-(trifluoromethyl)octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 89270021 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2Z,4Z,6Z)-2-methyl-3-(trifluoromethyl)octa-2,4,6-trien-1-amine |
| SMILES | C/C=C\C=C/C(=C(\C)CN)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-3-4-5-6-9(8(2)7-14)10(11,12)13/h3-6H,7,14H2,1-2H3/b4-3-,6-5-,9-8- |
| InChIKey | HBBFZBHAGXLALO-AAKIXIBCSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|