About (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine
(3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine (PubChem CID 70311731) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine.
Analyze (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The IUPAC name of (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine (CID 70311731) is (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine.
What is the SMILES notation for (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The canonical SMILES for (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine is NCC1=CC(F)C(F)C=C1.
What is the InChIKey of (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
The InChIKey is WKGFQKWMYVRAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3,6-7H,4,10H2.
What are the key properties of (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine?
(3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine has a molecular weight of 145.15 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorocyclohexa-1,5-dien-1-yl)methanamine is sourced from PubChem (CID 70311731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).