C6H7F2N — CID 23505194
5,6-difluorocyclohexa-2,4-dien-1-amine (PubChem CID 23505194) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is 5,6-difluorocyclohexa-2,4-dien-1-amine.
| Compound Name | 5,6-difluorocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 23505194 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 5,6-difluorocyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC=C(F)C1F |
| InChI | InChI=1S/C6H7F2N/c7-4-2-1-3-5(9)6(4)8/h1-3,5-6H,9H2 |
| InChIKey | XWNBPZXWQNGMGH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |