C8H10F5N — CID 89073924
(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dien-1-amine (PubChem CID 89073924) has the molecular formula C8H10F5N and a molecular weight of 215.16 g/mol. Its IUPAC name is (2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dien-1-amine.
| Compound Name | (2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89073924 |
| Molecular Formula | C8H10F5N |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dien-1-amine |
| SMILES | CC/C(F)=C(C(\F)=C/CN)/C(F)(F)F |
| InChI | InChI=1S/C8H10F5N/c1-2-5(9)7(8(11,12)13)6(10)3-4-14/h3H,2,4,14H2,1H3/b6-3+,7-5- |
| InChIKey | UJGVNJOLMVNJDW-MZECIPTHSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|