C10H16FN — CID 142367099
(2E,4Z,6E)-6-(fluoromethylidene)-N-methylocta-2,4-dien-1-amine (PubChem CID 142367099) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (2E,4Z,6E)-6-(fluoromethylidene)-N-methylocta-2,4-dien-1-amine.
| Compound Name | (2E,4Z,6E)-6-(fluoromethylidene)-N-methylocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142367099 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (2E,4Z,6E)-6-(fluoromethylidene)-N-methylocta-2,4-dien-1-amine |
| SMILES | CCC(/C=C\C=C\CNC)=C\F |
| InChI | InChI=1S/C10H16FN/c1-3-10(9-11)7-5-4-6-8-12-2/h4-7,9,12H,3,8H2,1-2H3/b6-4+,7-5-,10-9+ |
| InChIKey | CRHLKKJRASQNCR-PVBNJOCYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|