C13H21FN2 — CID 166773525
(1Z,3E)-3-fluoro-5-methylidene-1-N-(2-methylpropyl)octa-1,3,7-triene-1,6-diamine (PubChem CID 166773525) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is (1Z,3E)-3-fluoro-5-methylidene-1-N-(2-methylpropyl)octa-1,3,7-triene-1,6-diamine.
| Compound Name | (1Z,3E)-3-fluoro-5-methylidene-1-N-(2-methylpropyl)octa-1,3,7-triene-1,6-diamine |
|---|---|
| PubChem CID | 166773525 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (1Z,3E)-3-fluoro-5-methylidene-1-N-(2-methylpropyl)octa-1,3,7-triene-1,6-diamine |
| SMILES | C=CC(N)C(=C)/C=C(F)\C=C/NCC(C)C |
| InChI | InChI=1S/C13H21FN2/c1-5-13(15)11(4)8-12(14)6-7-16-9-10(2)3/h5-8,10,13,16H,1,4,9,15H2,2-3H3/b7-6-,12-8+ |
| InChIKey | VGZMVIAMLPUCRL-UGLNBITBSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|