C12H13F2N — CID 135193069
(2E,6E)-5,9-difluoro-4,5,7a,11a-tetrahydro-1H-1-benzazonine (PubChem CID 135193069) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is (2E,6E)-5,9-difluoro-4,5,7a,11a-tetrahydro-1H-1-benzazonine.
| Compound Name | (2E,6E)-5,9-difluoro-4,5,7a,11a-tetrahydro-1H-1-benzazonine |
|---|---|
| PubChem CID | 135193069 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (2E,6E)-5,9-difluoro-4,5,7a,11a-tetrahydro-1H-1-benzazonine |
| SMILES | FC1=CC2/C=C/C(F)C/C=C/NC2C=C1 |
| InChI | InChI=1S/C12H13F2N/c13-10-2-1-7-15-12-6-5-11(14)8-9(12)3-4-10/h1,3-10,12,15H,2H2/b4-3+,7-1+ |
| InChIKey | RIERMYQXJQGKTA-WZQVGYOOSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|