About 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine
6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 126671560) has the molecular formula C9H12F3N
and a molecular weight of 191.20 g/mol. Its IUPAC name is 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine.
Analyze 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine (CID 126671560) is 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine is CC(C)C1=CC=CC(C(F)(F)F)N1.
What is the InChIKey of 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is GANOHCUVVLUMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N/c1-6(2)7-4-3-5-8(13-7)9(10,11)12/h3-6,8,13H,1-2H3.
What are the key properties of 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine?
6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 191.20 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-2-(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 126671560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).