About 3a,7a-dihydro-1H-indole
3a,7a-dihydro-1H-indole (PubChem CID 20577477) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 3a,7a-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1H-indole |
| PubChem CID | 20577477 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 3a,7a-dihydro-1H-indole |
| SMILES | C1=CC2C=CNC2C=C1 |
| InChI | InChI=1S/C8H9N/c1-2-4-8-7(3-1)5-6-9-8/h1-9H |
| InChIKey | HXAOUQJUSHASIJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3a,7a-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1H-indole?
The IUPAC name of 3a,7a-dihydro-1H-indole (CID 20577477) is 3a,7a-dihydro-1H-indole.
What is the SMILES notation for 3a,7a-dihydro-1H-indole?
The canonical SMILES for 3a,7a-dihydro-1H-indole is C1=CC2C=CNC2C=C1.
What is the InChIKey of 3a,7a-dihydro-1H-indole?
The InChIKey is HXAOUQJUSHASIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-2-4-8-7(3-1)5-6-9-8/h1-9H.
What are the key properties of 3a,7a-dihydro-1H-indole?
3a,7a-dihydro-1H-indole has a molecular weight of 119.17 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1H-indole is sourced from PubChem (CID 20577477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).