C8H11FN2 — CID 90228826
2-(azetidin-3-yl)-3-fluoro-1,2-dihydropyridine (PubChem CID 90228826) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-3-fluoro-1,2-dihydropyridine.
| Compound Name | 2-(azetidin-3-yl)-3-fluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 90228826 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2-(azetidin-3-yl)-3-fluoro-1,2-dihydropyridine |
| SMILES | FC1=CC=CNC1C1CNC1 |
| InChI | InChI=1S/C8H11FN2/c9-7-2-1-3-11-8(7)6-4-10-5-6/h1-3,6,8,10-11H,4-5H2 |
| InChIKey | LBHHVOBTKOQZST-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |