C8H10N2 — CID 130281332
3a,4-dihydro-1H-indol-4-amine (PubChem CID 130281332) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 3a,4-dihydro-1H-indol-4-amine.
| Compound Name | 3a,4-dihydro-1H-indol-4-amine |
|---|---|
| PubChem CID | 130281332 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3a,4-dihydro-1H-indol-4-amine |
| SMILES | NC1C=CC=C2NC=CC21 |
| InChI | InChI=1S/C8H10N2/c9-7-2-1-3-8-6(7)4-5-10-8/h1-7,10H,9H2 |
| InChIKey | CYZKUGPUGJDKMN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |