C10H14N2 — CID 67559680
2-(5,6-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 67559680) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-(5,6-dihydro-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(5,6-dihydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 67559680 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-(5,6-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | NCCc1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C10H14N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h3-4,7,12H,1-2,5-6,11H2 |
| InChIKey | YZWJDMRAXSOPNC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |